| Name |
2-(6-Bromo-1,8-diethyl-1,3,4,9-tetrahydro-pyrano[3,4-b]indol-1-yl)-ethanol
|
| Molecular Formula |
C17H22BrNO2
|
| Molecular Weight |
352.3
|
| Smiles |
CCc1cc(Br)cc2c3c([nH]c12)C(CC)(CCO)OCC3
|
CCc1cc(Br)cc2c3c([nH]c12)C(CC)(CCO)OCC3
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.