| Name |
2-(4-Fluorophenyl)-4-[({5-methyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl}sulfanyl)methyl]-1,3-thiazole
|
| Molecular Formula |
C21H15FN4S2
|
| Molecular Weight |
406.5
|
| Smiles |
Cc1cc2nnc(SCc3csc(-c4ccc(F)cc4)n3)n2c2ccccc12
|
Cc1cc2nnc(SCc3csc(-c4ccc(F)cc4)n3)n2c2ccccc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.