| Name |
5-amino-N-(1,3-benzodioxol-5-ylmethyl)-1-(3-fluorobenzyl)-1H-1,2,3-triazole-4-carboxamide
|
| Molecular Formula |
C18H16FN5O3
|
| Molecular Weight |
369.3
|
| Smiles |
Nc1c(C(=O)NCc2ccc3c(c2)OCO3)nnn1Cc1cccc(F)c1
|
Nc1c(C(=O)NCc2ccc3c(c2)OCO3)nnn1Cc1cccc(F)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.