| Name |
10,12-Dimethyl-4,7-dithia-3,9-diazatricyclo[6.4.0.0{2,6}]dodeca-1(8),2,5,9,11-pentaen-5-amine
|
| Molecular Formula |
C10H9N3S2
|
| Molecular Weight |
235.3
|
| Smiles |
Cc1cc(C)c2c(n1)sc1c(N)snc12
|
Cc1cc(C)c2c(n1)sc1c(N)snc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.