| Name |
N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[2,4-dioxo-1-({[(oxolan-2-yl)methyl]carbamoyl}methyl)-1,2,3,4-tetrahydroquinazolin-3-yl]propanamide
|
| Molecular Formula |
C28H34N4O7
|
| Molecular Weight |
538.6
|
| Smiles |
COc1ccc(CCNC(=O)CCn2c(=O)c3ccccc3n(CC(=O)NCC3CCCO3)c2=O)cc1OC
|
COc1ccc(CCNC(=O)CCn2c(=O)c3ccccc3n(CC(=O)NCC3CCCO3)c2=O)cc1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.