| Name |
1-(4-chlorobenzyl)-5-(3,4-dimethylphenyl)-1,6a-dihydropyrrolo[3,4-d][1,2,3]triazole-4,6(3aH,5H)-dione
|
| Molecular Formula |
C19H17ClN4O2
|
| Molecular Weight |
368.8
|
| Smiles |
Cc1ccc(N2C(=O)C3N=NN(Cc4ccc(Cl)cc4)C3C2=O)cc1C
|
Cc1ccc(N2C(=O)C3N=NN(Cc4ccc(Cl)cc4)C3C2=O)cc1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.