| Name |
Isobutyl 5-(4-chlorophenyl)-1,3,7-trimethyl-2,4-dioxo-1,2,3,4,5,8-hexahydropyrido[2,3-d]pyrimidine-6-carboxylate
|
| Molecular Formula |
C21H24ClN3O4
|
| Molecular Weight |
417.9
|
| Smiles |
CC1=C(C(=O)OCC(C)C)C(c2ccc(Cl)cc2)c2c(n(C)c(=O)n(C)c2=O)N1
|
CC1=C(C(=O)OCC(C)C)C(c2ccc(Cl)cc2)c2c(n(C)c(=O)n(C)c2=O)N1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.