| Name |
4h-1-Benzopyran-4-one,3-amino-7-methoxy-,hydrochloride
|
| Molecular Formula |
C10H10ClNO3
|
| Molecular Weight |
227.64
|
| Smiles |
COc1ccc2c(=O)c(N)coc2c1.Cl
|
COc1ccc2c(=O)c(N)coc2c1.Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.