| Name |
2-(2-(Diethylamino)ethyl)-1-(2-methoxyphenyl)-6,7-dimethyl-1,2-dihydrochromeno[2,3-c]pyrrole-3,9-dione
|
| Molecular Formula |
C26H30N2O4
|
| Molecular Weight |
434.5
|
| Smiles |
CCN(CC)CCN1C(=O)c2oc3cc(C)c(C)cc3c(=O)c2C1c1ccccc1OC
|
CCN(CC)CCN1C(=O)c2oc3cc(C)c(C)cc3c(=O)c2C1c1ccccc1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.