| Name |
N~4~-(3-chloro-4-methylphenyl)-N~6~-(furan-2-ylmethyl)-1-methyl-1H-pyrazolo[3,4-d]pyrimidine-4,6-diamine
|
| Molecular Formula |
C18H17ClN6O
|
| Molecular Weight |
368.8
|
| Smiles |
Cc1ccc(Nc2nc(NCc3ccco3)nc3c2cnn3C)cc1Cl
|
Cc1ccc(Nc2nc(NCc3ccco3)nc3c2cnn3C)cc1Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.