| Name |
N-(5-methoxybenzo[d]thiazol-2-yl)-N-(3-morpholinopropyl)-2,3-dihydrobenzo[b][1,4]dioxine-6-carboxamide hydrochloride
|
| Molecular Formula |
C24H28ClN3O5S
|
| Molecular Weight |
506.0
|
| Smiles |
COc1ccc2sc(N(CCCN3CCOCC3)C(=O)c3ccc4c(c3)OCCO4)nc2c1.Cl
|
COc1ccc2sc(N(CCCN3CCOCC3)C(=O)c3ccc4c(c3)OCCO4)nc2c1.Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.