| Name |
7-(4-methoxybenzoyl)-5-[(3-methoxyphenyl)methyl]-2H,5H,8H-[1,3]dioxolo[4,5-g]quinolin-8-one
|
| Molecular Formula |
C26H21NO6
|
| Molecular Weight |
443.4
|
| Smiles |
COc1ccc(C(=O)c2cn(Cc3cccc(OC)c3)c3cc4c(cc3c2=O)OCO4)cc1
|
COc1ccc(C(=O)c2cn(Cc3cccc(OC)c3)c3cc4c(cc3c2=O)OCO4)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.