| Name |
N-(3-ethylphenyl)-2-{8-fluoro-5-[(3-methylphenyl)methyl]-3-oxo-2H,3H,5H-pyrazolo[4,3-c]quinolin-2-yl}acetamide
|
| Molecular Formula |
C28H25FN4O2
|
| Molecular Weight |
468.5
|
| Smiles |
CCc1cccc(NC(=O)Cn2nc3c4cc(F)ccc4n(Cc4cccc(C)c4)cc-3c2=O)c1
|
CCc1cccc(NC(=O)Cn2nc3c4cc(F)ccc4n(Cc4cccc(C)c4)cc-3c2=O)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.