| Name |
Methyl 4,6-bis-O-(phenylmethyl)-2,3-bis-O-(trimethylsilyl)-I+/--D-mannopyranoside
|
| Molecular Formula |
C27H42O6Si2
|
| Molecular Weight |
518.8
|
| Smiles |
COC1OC(COCc2ccccc2)C(OCc2ccccc2)C(O[Si](C)(C)C)C1O[Si](C)(C)C
|
COC1OC(COCc2ccccc2)C(OCc2ccccc2)C(O[Si](C)(C)C)C1O[Si](C)(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.