| Name |
2-Cyclohexyl-7-methyl-5,6,7,8-tetrahydro-benzo[4,5]thieno[2,3-d]pyrimidin-4-ol
|
| Molecular Formula |
C17H22N2OS
|
| Molecular Weight |
302.4
|
| Smiles |
CC1CCc2c(sc3nc(C4CCCCC4)[nH]c(=O)c23)C1
|
CC1CCc2c(sc3nc(C4CCCCC4)[nH]c(=O)c23)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.