| Name |
2-((3-(Thiophen-2-yl)-1,2,4-oxadiazol-5-yl)methyl)isoindoline-1,3-dione
|
| Molecular Formula |
C15H9N3O3S
|
| Molecular Weight |
311.3
|
| Smiles |
O=C1c2ccccc2C(=O)N1Cc1nc(-c2cccs2)no1
|
O=C1c2ccccc2C(=O)N1Cc1nc(-c2cccs2)no1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.