| Name |
ethyl 2-amino-4-(2,4-dichlorophenyl)-5-oxo-4H,5H-thiochromeno[4,3-b]pyran-3-carboxylate
|
| Molecular Formula |
C21H15Cl2NO4S
|
| Molecular Weight |
448.3
|
| Smiles |
CCOC(=O)C1=C(N)Oc2c(c(=O)sc3ccccc23)C1c1ccc(Cl)cc1Cl
|
CCOC(=O)C1=C(N)Oc2c(c(=O)sc3ccccc23)C1c1ccc(Cl)cc1Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.