| Name |
dimethyl 1-{1-[(2-fluorophenyl)amino]-1-oxobutan-2-yl}-1H-1,2,3-triazole-4,5-dicarboxylate
|
| Molecular Formula |
C16H17FN4O5
|
| Molecular Weight |
364.33
|
| Smiles |
CCC(C(=O)Nc1ccccc1F)n1nnc(C(=O)OC)c1C(=O)OC
|
CCC(C(=O)Nc1ccccc1F)n1nnc(C(=O)OC)c1C(=O)OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.