| Name |
(5Z)-3-hexyl-5-({3-[2-methyl-4-(prop-2-en-1-yloxy)phenyl]-1-phenyl-1H-pyrazol-4-yl}methylidene)-2-thioxo-1,3-thiazolidin-4-one
|
| Molecular Formula |
C29H31N3O2S2
|
| Molecular Weight |
517.7
|
| Smiles |
C=CCOc1ccc(-c2nn(-c3ccccc3)cc2C=C2SC(=S)N(CCCCCC)C2=O)c(C)c1
|
C=CCOc1ccc(-c2nn(-c3ccccc3)cc2C=C2SC(=S)N(CCCCCC)C2=O)c(C)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.