| Name |
2-[(4-Cyclopropyl-4,5-dihydro-5-oxo-1H-1,2,4-triazol-3-yl)thio]-N-(2,3-dihydro-1,5-dimethyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)propanamide
|
| Molecular Formula |
C19H22N6O3S
|
| Molecular Weight |
414.5
|
| Smiles |
Cc1c(NC(=O)C(C)Sc2n[nH]c(=O)n2C2CC2)c(=O)n(-c2ccccc2)n1C
|
Cc1c(NC(=O)C(C)Sc2n[nH]c(=O)n2C2CC2)c(=O)n(-c2ccccc2)n1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.