| Name |
2-((2-(3,4-dihydroquinolin-1(2H)-yl)-2-oxoethyl)thio)-3-(3,5-dimethylphenyl)-6,7-dihydrothieno[3,2-d]pyrimidin-4(3H)-one
|
| Molecular Formula |
C25H25N3O2S2
|
| Molecular Weight |
463.6
|
| Smiles |
Cc1cc(C)cc(-n2c(SCC(=O)N3CCCc4ccccc43)nc3c(c2=O)SCC3)c1
|
Cc1cc(C)cc(-n2c(SCC(=O)N3CCCc4ccccc43)nc3c(c2=O)SCC3)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.