| Name |
N-(4-{7-methylimidazo[1,2-a]pyrimidin-2-yl}phenyl)-[1,1'-biphenyl]-4-sulfonamide
|
| Molecular Formula |
C25H20N4O2S
|
| Molecular Weight |
440.5
|
| Smiles |
Cc1ccn2cc(-c3ccc(NS(=O)(=O)c4ccc(-c5ccccc5)cc4)cc3)nc2n1
|
Cc1ccn2cc(-c3ccc(NS(=O)(=O)c4ccc(-c5ccccc5)cc4)cc3)nc2n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.