| Name |
4-amino-1-((2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyltetrahydrofuran-2-yl)pyrimidin-2(1H)-one
|
| Molecular Formula |
C10H15N3O5
|
| Molecular Weight |
257.24
|
| Smiles |
CC1(O)C(O)C(CO)OC1n1ccc(N)nc1=O
|
CC1(O)C(O)C(CO)OC1n1ccc(N)nc1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.