| Name |
2-(furan-2-carbonyl)-1H,2H,3H,4H,5H-pyrido[4,3-b]indole
|
| Molecular Formula |
C16H14N2O2
|
| Molecular Weight |
266.29
|
| Smiles |
O=C(c1ccco1)N1CCc2[nH]c3ccccc3c2C1
|
O=C(c1ccco1)N1CCc2[nH]c3ccccc3c2C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.