| Name |
2-((3-(3,4-dimethoxyphenyl)-4-oxo-3,4,6,7-tetrahydrothieno[3,2-d]pyrimidin-2-yl)thio)-N-(p-tolyl)acetamide
|
| Molecular Formula |
C23H23N3O4S2
|
| Molecular Weight |
469.6
|
| Smiles |
COc1ccc(-n2c(SCC(=O)Nc3ccc(C)cc3)nc3c(c2=O)SCC3)cc1OC
|
COc1ccc(-n2c(SCC(=O)Nc3ccc(C)cc3)nc3c(c2=O)SCC3)cc1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.