| Name |
3-(4-bromo-3-methylphenyl)-2-methyl-8-nitro-5,6-dihydro-2H-2,6-methanobenzo[g][1,3,5]oxadiazocin-4(3H)-one
|
| Molecular Formula |
C18H16BrN3O4
|
| Molecular Weight |
418.2
|
| Smiles |
Cc1cc(N2C(=O)NC3CC2(C)Oc2ccc([N+](=O)[O-])cc23)ccc1Br
|
Cc1cc(N2C(=O)NC3CC2(C)Oc2ccc([N+](=O)[O-])cc23)ccc1Br
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.