| Name |
8,10-dichloro-3-(3,4-dimethoxyphenyl)-2-methyl-5,6-dihydro-2H-2,6-methanobenzo[g][1,3,5]oxadiazocin-4(3H)-one
|
| Molecular Formula |
C19H18Cl2N2O4
|
| Molecular Weight |
409.3
|
| Smiles |
COc1ccc(N2C(=O)NC3CC2(C)Oc2c(Cl)cc(Cl)cc23)cc1OC
|
COc1ccc(N2C(=O)NC3CC2(C)Oc2c(Cl)cc(Cl)cc23)cc1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.