| Name |
Ethyl 3-[1-(3-methoxyphenyl)-4,6-dimethyl-2-oxo-1,2-dihydropyridin-3-yl]-1,2,4-oxadiazole-5-carboxylate
|
| Molecular Formula |
C19H19N3O5
|
| Molecular Weight |
369.4
|
| Smiles |
CCOC(=O)c1nc(-c2c(C)cc(C)n(-c3cccc(OC)c3)c2=O)no1
|
CCOC(=O)c1nc(-c2c(C)cc(C)n(-c3cccc(OC)c3)c2=O)no1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.