| Name |
1,1-Difluoroethyl 2,2,3,3,3-pentafluoropropyl ether
|
| Molecular Formula |
C5H5F7O
|
| Molecular Weight |
214.08
|
| Smiles |
CC(F)(F)OCC(F)(F)C(F)(F)F
|
CC(F)(F)OCC(F)(F)C(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.