| Name |
3,3,6,6-tetramethyloctane-1,1,8,8-tetrol
|
| Molecular Formula |
C12H26O4
|
| Molecular Weight |
234.33
|
| Smiles |
CC(C)(CCC(C)(C)CC(O)O)CC(O)O
|
CC(C)(CCC(C)(C)CC(O)O)CC(O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.