| Name |
Ethyl 5-chloro-2,4-dioxo-1,2,3,4-tetrahydropyrrolo[1,2-b]pyridazine-3-carboxylate
|
| Molecular Formula |
C10H9ClN2O4
|
| Molecular Weight |
256.64
|
| Smiles |
CCOC(=O)C1C(=O)Nn2ccc(Cl)c2C1=O
|
CCOC(=O)C1C(=O)Nn2ccc(Cl)c2C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.