| Name |
4-(2-ethoxyphenyl)-4,7-dihydrofuro[3,4-d]pyrimidine-2,5(1H,3H)-dione
|
| Molecular Formula |
C14H14N2O4
|
| Molecular Weight |
274.27
|
| Smiles |
CCOc1ccccc1C1NC(=O)NC2=C1C(=O)OC2
|
CCOc1ccccc1C1NC(=O)NC2=C1C(=O)OC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.