| Name |
2-(((3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl)methyl)thio)-3-(4-fluorobenzyl)quinazolin-4(3H)-one
|
| Molecular Formula |
C24H16BrFN4O2S
|
| Molecular Weight |
523.4
|
| Smiles |
O=c1c2ccccc2nc(SCc2nc(-c3cccc(Br)c3)no2)n1Cc1ccc(F)cc1
|
O=c1c2ccccc2nc(SCc2nc(-c3cccc(Br)c3)no2)n1Cc1ccc(F)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.