| Name |
6-Benzyl-2,3-dichloro-5,6,7,8-tetrahydro-1,6-naphthyridine
|
| Molecular Formula |
C15H14Cl2N2
|
| Molecular Weight |
293.2
|
| Smiles |
Clc1cc2c(nc1Cl)CCN(Cc1ccccc1)C2
|
Clc1cc2c(nc1Cl)CCN(Cc1ccccc1)C2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.