| Name |
6-fluoro-1-methyl-1H-2,1-benzothiazin-4(3H)-one 2,2-dioxide
|
| Molecular Formula |
C9H8FNO3S
|
| Molecular Weight |
229.23
|
| Smiles |
CN1c2ccc(F)cc2C(=O)CS1(=O)=O
|
CN1c2ccc(F)cc2C(=O)CS1(=O)=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.