| Name |
(4,8-Bis(5-(2-ethylhexyl)selenophen-2-yl)benzo[1,2-b:4,5-b']dithiophene-2,6-diyl)bis(trimethylstannane)
|
| Molecular Formula |
C40H58S2Se2Sn2
|
| Molecular Weight |
998.4
|
| Smiles |
CCCCC(CC)Cc1ccc(-c2c3cc([Sn](C)(C)C)sc3c(-c3ccc(CC(CC)CCCC)[se]3)c3cc([Sn](C)(C)C)sc23)[se]1
|
CCCCC(CC)Cc1ccc(-c2c3cc([Sn](C)(C)C)sc3c(-c3ccc(CC(CC)CCCC)[se]3)c3cc([Sn](C)(C)C)sc23)[se]1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.