| Name |
1-ethyl-1H-thieno[3,2-c][1,2]thiazin-4(3H)-one 2,2-dioxide
|
| Molecular Formula |
C8H9NO3S2
|
| Molecular Weight |
231.3
|
| Smiles |
CCN1c2ccsc2C(=O)CS1(=O)=O
|
CCN1c2ccsc2C(=O)CS1(=O)=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.