| Name |
N1,N1-diethyl-N2,4-dimethylpentane-1,2-diamine dihydrochloride
|
| Molecular Formula |
C11H28Cl2N2
|
| Molecular Weight |
259.26
|
| Smiles |
CCN(CC)CC(CC(C)C)NC.Cl.Cl
|
CCN(CC)CC(CC(C)C)NC.Cl.Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.