| Name |
Cyclopentyl 4-(3-methyl-[1,2,4]triazolo[4,3-a]pyrazin-8-yl)piperazine-1-carboxylate
|
| Molecular Formula |
C16H22N6O2
|
| Molecular Weight |
330.38
|
| Smiles |
Cc1nnc2c(N3CCN(C(=O)OC4CCCC4)CC3)nccn12
|
Cc1nnc2c(N3CCN(C(=O)OC4CCCC4)CC3)nccn12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.