| Name |
4-methyl-N-[(1r,4r)-4-[(3-cyanopyrazin-2-yl)oxy]cyclohexyl]thiophene-2-carboxamide
|
| Molecular Formula |
C17H18N4O2S
|
| Molecular Weight |
342.4
|
| Smiles |
Cc1csc(C(=O)NC2CCC(Oc3nccnc3C#N)CC2)c1
|
Cc1csc(C(=O)NC2CCC(Oc3nccnc3C#N)CC2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.