| Name |
1-(2-methoxyethyl)-4-(4-methoxyphenyl)-4,7-dihydrofuro[3,4-d]pyrimidine-2,5(1H,3H)-dione
|
| Molecular Formula |
C16H18N2O5
|
| Molecular Weight |
318.32
|
| Smiles |
COCCN1C(=O)NC(c2ccc(OC)cc2)C2=C1COC2=O
|
COCCN1C(=O)NC(c2ccc(OC)cc2)C2=C1COC2=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.