| Name |
1-(3-(2-Chlorodibenz(b,E)oxepin-11(6H)-ylidene)propyl)piperazine dihydrochloride, (E)-
|
| Molecular Formula |
C21H25Cl3N2O
|
| Molecular Weight |
427.8
|
| Smiles |
Cl.Cl.Clc1ccc2c(c1)C(=CCCN1CCNCC1)c1ccccc1CO2
|
Cl.Cl.Clc1ccc2c(c1)C(=CCCN1CCNCC1)c1ccccc1CO2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.