| Name |
Cyclotrisiloxane, 2-methyl-4-((3-methyl-1,1,5,5,5-pentakis(1-methylpropoxy)-3-((tris(1-methylpropoxy)silyl)oxy)trisiloxanyl)oxy)-4,6,6-tris(1-methylpropoxy)-2-((tris(1-methylpropoxy)silyl)oxy)-
|
| Molecular Formula |
C58H132O22Si8
|
| Molecular Weight |
1406.3
|
| Smiles |
CCC(C)O[Si](OC(C)CC)(OC(C)CC)O[Si](C)(O[Si](OC(C)CC)(OC(C)CC)OC(C)CC)O[Si](OC(C)CC)(OC(C)CC)O[Si]1(OC(C)CC)O[Si](C)(O[Si](OC(C)CC)(OC(C)CC)OC(C)CC)O[Si](OC(C)CC)(OC(C)CC)O1
|
CCC(C)O[Si](OC(C)CC)(OC(C)CC)O[Si](C)(O[Si](OC(C)CC)(OC(C)CC)OC(C)CC)O[Si](OC(C)CC)(OC(C)CC)O[Si]1(OC(C)CC)O[Si](C)(O[Si](OC(C)CC)(OC(C)CC)OC(C)CC)O[Si](OC(C)CC)(OC(C)CC)O1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.