| Name |
(3S,8R,Z)-Heptadeca-1,9-dien-4,6-diyne-3,8-diol
|
| Molecular Formula |
C17H24O2
|
| Molecular Weight |
260.4
|
| Smiles |
C=CC(O)C#CC#CC(O)C=CCCCCCCC
|
C=CC(O)C#CC#CC(O)C=CCCCCCCC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.