| Name |
[1,2,4]triazolo[1,5-a]pyrimidin-2-yl(4-(1,1-dioxidotetrahydro-2H-thiopyran-4-yl)piperazin-1-yl)methanone
|
| Molecular Formula |
C15H20N6O3S
|
| Molecular Weight |
364.4
|
| Smiles |
O=C(c1nc2ncccn2n1)N1CCN(C2CCS(=O)(=O)CC2)CC1
|
O=C(c1nc2ncccn2n1)N1CCN(C2CCS(=O)(=O)CC2)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.