| Name |
2-((2E)-3,7-Dimethyl-2,6-octadien-1-yl)-6-(ethylamino)-3-hydroxy-5-pentyl-2,5-cyclohexadiene-1,4-dione
|
| Molecular Formula |
C23H35NO3
|
| Molecular Weight |
373.5
|
| Smiles |
CCCCCC1=C(NCC)C(O)=C(CC=C(C)CCC=C(C)C)C(=O)C1=O
|
CCCCCC1=C(NCC)C(O)=C(CC=C(C)CCC=C(C)C)C(=O)C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.