| Name |
4,6-Dichloro-1-(2,4-difluorophenyl)pyrazolo[3,4-D]pyrimidine
|
| Molecular Formula |
C11H4Cl2F2N4
|
| Molecular Weight |
301.08
|
| Smiles |
Fc1ccc(-n2ncc3c(Cl)nc(Cl)nc32)c(F)c1
|
Fc1ccc(-n2ncc3c(Cl)nc(Cl)nc32)c(F)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.