| Name |
2-Methyl-3-(3,7,11,15-tetramethyl-2,14-hexadecadien-1-yl)-1,4-naphthalenedione
|
| Molecular Formula |
C31H44O2
|
| Molecular Weight |
448.7
|
| Smiles |
CC(C)=CCCC(C)CCCC(C)CCCC(C)=CCC1=C(C)C(=O)c2ccccc2C1=O
|
CC(C)=CCCC(C)CCCC(C)CCCC(C)=CCC1=C(C)C(=O)c2ccccc2C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.