| Name |
1-(4-(Benzyloxy)-7-((2,6-dimethylphenyl)thio)-6-methoxy-1-phenylnaphthalen-2-yl)-3,3,5,5-tetramethylcyclohexan-1-ol
|
| Molecular Formula |
C42H46O3S
|
| Molecular Weight |
630.9
|
| Smiles |
COc1cc2c(OCc3ccccc3)cc(C3(O)CC(C)(C)CC(C)(C)C3)c(-c3ccccc3)c2cc1Sc1c(C)cccc1C
|
COc1cc2c(OCc3ccccc3)cc(C3(O)CC(C)(C)CC(C)(C)C3)c(-c3ccccc3)c2cc1Sc1c(C)cccc1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.