| Name |
2-((4-isopropylbenzyl)thio)-3,7-diphenyl-3H-pyrrolo[3,2-d]pyrimidin-4(5H)-one
|
| Molecular Formula |
C28H25N3OS
|
| Molecular Weight |
451.6
|
| Smiles |
CC(C)c1ccc(CSc2nc3c(-c4ccccc4)c[nH]c3c(=O)n2-c2ccccc2)cc1
|
CC(C)c1ccc(CSc2nc3c(-c4ccccc4)c[nH]c3c(=O)n2-c2ccccc2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.